C13H17Cl2FN2O2 — CID 86780110
[2-(1-aminoethyl)morpholin-4-yl]-(2-chloro-4-fluorophenyl)methanone;hydrochloride (PubChem CID 86780110) has the molecular formula C13H17Cl2FN2O2 and a molecular weight of 323.20 g/mol. Its IUPAC name is [2-(1-aminoethyl)morpholin-4-yl]-(2-chloro-4-fluorophenyl)methanone;hydrochloride.
| Compound Name | [2-(1-aminoethyl)morpholin-4-yl]-(2-chloro-4-fluorophenyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 86780110 |
| Molecular Formula | C13H17Cl2FN2O2 |
| Molecular Weight | 323.20 g/mol |
| Exact Mass | 322.07 |
| IUPAC Name | [2-(1-aminoethyl)morpholin-4-yl]-(2-chloro-4-fluorophenyl)methanone;hydrochloride |
| SMILES | CC(N)C1CN(C(=O)c2ccc(F)cc2Cl)CCO1.Cl |
| InChI | InChI=1S/C13H16ClFN2O2.ClH/c1-8(16)12-7-17(4-5-19-12)13(18)10-3-2-9(15)6-11(10)14;/h2-3,6,8,12H,4-5,7,16H2,1H3;1H |
| InChIKey | FIIGJDIFKYBQOP-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.20 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |