C14H19ClN2O3 — CID 81484092
[2-(1-aminoethyl)morpholin-4-yl]-(5-chloro-2-methoxyphenyl)methanone (PubChem CID 81484092) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is [2-(1-aminoethyl)morpholin-4-yl]-(5-chloro-2-methoxyphenyl)methanone.
| Compound Name | [2-(1-aminoethyl)morpholin-4-yl]-(5-chloro-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 81484092 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [2-(1-aminoethyl)morpholin-4-yl]-(5-chloro-2-methoxyphenyl)methanone |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCOC(C(C)N)C1 |
| InChI | InChI=1S/C14H19ClN2O3/c1-9(16)13-8-17(5-6-20-13)14(18)11-7-10(15)3-4-12(11)19-2/h3-4,7,9,13H,5-6,8,16H2,1-2H3 |
| InChIKey | MPNQRQSGPRMZDI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |