C11H13ClN2O2 — CID 65244224
(3-aminoazetidin-1-yl)-(5-chloro-2-methoxyphenyl)methanone (PubChem CID 65244224) has the molecular formula C11H13ClN2O2 and a molecular weight of 240.69 g/mol. Its IUPAC name is (3-aminoazetidin-1-yl)-(5-chloro-2-methoxyphenyl)methanone.
| Compound Name | (3-aminoazetidin-1-yl)-(5-chloro-2-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 65244224 |
| Molecular Formula | C11H13ClN2O2 |
| Molecular Weight | 240.69 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | (3-aminoazetidin-1-yl)-(5-chloro-2-methoxyphenyl)methanone |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CC(N)C1 |
| InChI | InChI=1S/C11H13ClN2O2/c1-16-10-3-2-7(12)4-9(10)11(15)14-5-8(13)6-14/h2-4,8H,5-6,13H2,1H3 |
| InChIKey | VYYCWRCAXBJMKT-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.69 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |