C18H18ClNO4 — CID 70713898
(5-chloro-2-methoxyphenyl)-[3-(2-methoxyphenoxy)azetidin-1-yl]methanone (PubChem CID 70713898) has the molecular formula C18H18ClNO4 and a molecular weight of 347.80 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)-[3-(2-methoxyphenoxy)azetidin-1-yl]methanone.
| Compound Name | (5-chloro-2-methoxyphenyl)-[3-(2-methoxyphenoxy)azetidin-1-yl]methanone |
|---|---|
| PubChem CID | 70713898 |
| Molecular Formula | C18H18ClNO4 |
| Molecular Weight | 347.80 g/mol |
| Exact Mass | 347.09 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)-[3-(2-methoxyphenoxy)azetidin-1-yl]methanone |
| SMILES | COc1ccccc1OC1CN(C(=O)c2cc(Cl)ccc2OC)C1 |
| InChI | InChI=1S/C18H18ClNO4/c1-22-15-8-7-12(19)9-14(15)18(21)20-10-13(11-20)24-17-6-4-3-5-16(17)23-2/h3-9,13H,10-11H2,1-2H3 |
| InChIKey | JHPDXFFIOKCSCN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.80 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |