C13H18Cl2N2O — CID 119671331
(4-amino-2-chlorophenyl)-(3-methylpiperidin-1-yl)methanone;hydrochloride (PubChem CID 119671331) has the molecular formula C13H18Cl2N2O and a molecular weight of 289.21 g/mol. Its IUPAC name is (4-amino-2-chlorophenyl)-(3-methylpiperidin-1-yl)methanone;hydrochloride.
| Compound Name | (4-amino-2-chlorophenyl)-(3-methylpiperidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119671331 |
| Molecular Formula | C13H18Cl2N2O |
| Molecular Weight | 289.21 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | (4-amino-2-chlorophenyl)-(3-methylpiperidin-1-yl)methanone;hydrochloride |
| SMILES | CC1CCCN(C(=O)c2ccc(N)cc2Cl)C1.Cl |
| InChI | InChI=1S/C13H17ClN2O.ClH/c1-9-3-2-6-16(8-9)13(17)11-5-4-10(15)7-12(11)14;/h4-5,7,9H,2-3,6,8,15H2,1H3;1H |
| InChIKey | CMGRBJXHVIMFIW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|