C14H19ClN4O2 — CID 61109975
[1-(4-amino-2-chlorobenzoyl)piperidin-3-yl]methylurea (PubChem CID 61109975) has the molecular formula C14H19ClN4O2 and a molecular weight of 310.79 g/mol. Its IUPAC name is [1-(4-amino-2-chlorobenzoyl)piperidin-3-yl]methylurea.
| Compound Name | [1-(4-amino-2-chlorobenzoyl)piperidin-3-yl]methylurea |
|---|---|
| PubChem CID | 61109975 |
| Molecular Formula | C14H19ClN4O2 |
| Molecular Weight | 310.79 g/mol |
| Exact Mass | 310.12 |
| IUPAC Name | [1-(4-amino-2-chlorobenzoyl)piperidin-3-yl]methylurea |
| SMILES | NC(=O)NCC1CCCN(C(=O)c2ccc(N)cc2Cl)C1 |
| InChI | InChI=1S/C14H19ClN4O2/c15-12-6-10(16)3-4-11(12)13(20)19-5-1-2-9(8-19)7-18-14(17)21/h3-4,6,9H,1-2,5,7-8,16H2,(H3,17,18,21) |
| InChIKey | BSYKKWQZTRSNCG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 101.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.79 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|