C13H16Cl2N4O2 — CID 106993329
[1-(2,6-dichloropyridine-3-carbonyl)piperidin-3-yl]methylurea (PubChem CID 106993329) has the molecular formula C13H16Cl2N4O2 and a molecular weight of 331.20 g/mol. Its IUPAC name is [1-(2,6-dichloropyridine-3-carbonyl)piperidin-3-yl]methylurea.
| Compound Name | [1-(2,6-dichloropyridine-3-carbonyl)piperidin-3-yl]methylurea |
|---|---|
| PubChem CID | 106993329 |
| Molecular Formula | C13H16Cl2N4O2 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.07 |
| IUPAC Name | [1-(2,6-dichloropyridine-3-carbonyl)piperidin-3-yl]methylurea |
| SMILES | NC(=O)NCC1CCCN(C(=O)c2ccc(Cl)nc2Cl)C1 |
| InChI | InChI=1S/C13H16Cl2N4O2/c14-10-4-3-9(11(15)18-10)12(20)19-5-1-2-8(7-19)6-17-13(16)21/h3-4,8H,1-2,5-7H2,(H3,16,17,21) |
| InChIKey | QADZDZSQEFFDMM-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|