C11H16N4O2S — CID 55142865
[1-(1,3-thiazole-4-carbonyl)piperidin-3-yl]methylurea (PubChem CID 55142865) has the molecular formula C11H16N4O2S and a molecular weight of 268.34 g/mol. Its IUPAC name is [1-(1,3-thiazole-4-carbonyl)piperidin-3-yl]methylurea.
| Compound Name | [1-(1,3-thiazole-4-carbonyl)piperidin-3-yl]methylurea |
|---|---|
| PubChem CID | 55142865 |
| Molecular Formula | C11H16N4O2S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | [1-(1,3-thiazole-4-carbonyl)piperidin-3-yl]methylurea |
| SMILES | NC(=O)NCC1CCCN(C(=O)c2cscn2)C1 |
| InChI | InChI=1S/C11H16N4O2S/c12-11(17)13-4-8-2-1-3-15(5-8)10(16)9-6-18-7-14-9/h6-8H,1-5H2,(H3,12,13,17) |
| InChIKey | GPLGBMOAYBYTIZ-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |