C12H16ClN5O2 — CID 61053733
[1-(6-chloropyridazine-3-carbonyl)piperidin-3-yl]methylurea (PubChem CID 61053733) has the molecular formula C12H16ClN5O2 and a molecular weight of 297.75 g/mol. Its IUPAC name is [1-(6-chloropyridazine-3-carbonyl)piperidin-3-yl]methylurea.
| Compound Name | [1-(6-chloropyridazine-3-carbonyl)piperidin-3-yl]methylurea |
|---|---|
| PubChem CID | 61053733 |
| Molecular Formula | C12H16ClN5O2 |
| Molecular Weight | 297.75 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | [1-(6-chloropyridazine-3-carbonyl)piperidin-3-yl]methylurea |
| SMILES | NC(=O)NCC1CCCN(C(=O)c2ccc(Cl)nn2)C1 |
| InChI | InChI=1S/C12H16ClN5O2/c13-10-4-3-9(16-17-10)11(19)18-5-1-2-8(7-18)6-15-12(14)20/h3-4,8H,1-2,5-7H2,(H3,14,15,20) |
| InChIKey | KLPSLBVIXURTLW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 101.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.75 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |