C14H20N4O3 — CID 107074607
[1-(2-amino-5-hydroxybenzoyl)piperidin-3-yl]methylurea (PubChem CID 107074607) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is [1-(2-amino-5-hydroxybenzoyl)piperidin-3-yl]methylurea.
| Compound Name | [1-(2-amino-5-hydroxybenzoyl)piperidin-3-yl]methylurea |
|---|---|
| PubChem CID | 107074607 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | [1-(2-amino-5-hydroxybenzoyl)piperidin-3-yl]methylurea |
| SMILES | NC(=O)NCC1CCCN(C(=O)c2cc(O)ccc2N)C1 |
| InChI | InChI=1S/C14H20N4O3/c15-12-4-3-10(19)6-11(12)13(20)18-5-1-2-9(8-18)7-17-14(16)21/h3-4,6,9,19H,1-2,5,7-8,15H2,(H3,16,17,21) |
| InChIKey | DQBYMVUSHPUWQQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 121.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|