C15H20BrN3O2 — CID 80973642
[1-(2-bromo-5-methylbenzoyl)piperidin-3-yl]methylurea (PubChem CID 80973642) has the molecular formula C15H20BrN3O2 and a molecular weight of 354.25 g/mol. Its IUPAC name is [1-(2-bromo-5-methylbenzoyl)piperidin-3-yl]methylurea.
| Compound Name | [1-(2-bromo-5-methylbenzoyl)piperidin-3-yl]methylurea |
|---|---|
| PubChem CID | 80973642 |
| Molecular Formula | C15H20BrN3O2 |
| Molecular Weight | 354.25 g/mol |
| Exact Mass | 353.07 |
| IUPAC Name | [1-(2-bromo-5-methylbenzoyl)piperidin-3-yl]methylurea |
| SMILES | Cc1ccc(Br)c(C(=O)N2CCCC(CNC(N)=O)C2)c1 |
| InChI | InChI=1S/C15H20BrN3O2/c1-10-4-5-13(16)12(7-10)14(20)19-6-2-3-11(9-19)8-18-15(17)21/h4-5,7,11H,2-3,6,8-9H2,1H3,(H3,17,18,21) |
| InChIKey | ARWNSUDYSJZEOF-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.25 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |