C24H33N3O2 — CID 52861399
N-[[(3S)-1-[2-(2,5-dimethylpyrrol-1-yl)-5-methylbenzoyl]piperidin-3-yl]methyl]butanamide (PubChem CID 52861399) has the molecular formula C24H33N3O2 and a molecular weight of 395.55 g/mol. Its IUPAC name is N-[[(3S)-1-[2-(2,5-dimethylpyrrol-1-yl)-5-methylbenzoyl]piperidin-3-yl]methyl]butanamide.
| Compound Name | N-[[(3S)-1-[2-(2,5-dimethylpyrrol-1-yl)-5-methylbenzoyl]piperidin-3-yl]methyl]butanamide |
|---|---|
| PubChem CID | 52861399 |
| Molecular Formula | C24H33N3O2 |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | N-[[(3S)-1-[2-(2,5-dimethylpyrrol-1-yl)-5-methylbenzoyl]piperidin-3-yl]methyl]butanamide |
| SMILES | CCCC(=O)NC[C@@H]1CCCN(C(=O)c2cc(C)ccc2-n2c(C)ccc2C)C1 |
| InChI | InChI=1S/C24H33N3O2/c1-5-7-23(28)25-15-20-8-6-13-26(16-20)24(29)21-14-17(2)9-12-22(21)27-18(3)10-11-19(27)4/h9-12,14,20H,5-8,13,15-16H2,1-4H3,(H,25,28)/t20-/m0/s1 |
| InChIKey | NQXDEENPCTZKSY-FQEVSTJZSA-N |
| XLogP | 4.17 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|