C17H26ClN3O2 — CID 119761652
N-[[1-(3-aminobenzoyl)piperidin-3-yl]methyl]butanamide;hydrochloride (PubChem CID 119761652) has the molecular formula C17H26ClN3O2 and a molecular weight of 339.87 g/mol. Its IUPAC name is N-[[1-(3-aminobenzoyl)piperidin-3-yl]methyl]butanamide;hydrochloride.
| Compound Name | N-[[1-(3-aminobenzoyl)piperidin-3-yl]methyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119761652 |
| Molecular Formula | C17H26ClN3O2 |
| Molecular Weight | 339.87 g/mol |
| Exact Mass | 339.17 |
| IUPAC Name | N-[[1-(3-aminobenzoyl)piperidin-3-yl]methyl]butanamide;hydrochloride |
| SMILES | CCCC(=O)NCC1CCCN(C(=O)c2cccc(N)c2)C1.Cl |
| InChI | InChI=1S/C17H25N3O2.ClH/c1-2-5-16(21)19-11-13-6-4-9-20(12-13)17(22)14-7-3-8-15(18)10-14;/h3,7-8,10,13H,2,4-6,9,11-12,18H2,1H3,(H,19,21);1H |
| InChIKey | JCGALKZUESYXHC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.87 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|