C16H22N2O4S — CID 119183261
5-[3-[(butanoylamino)methyl]piperidine-1-carbonyl]thiophene-2-carboxylic acid (PubChem CID 119183261) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 5-[3-[(butanoylamino)methyl]piperidine-1-carbonyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[3-[(butanoylamino)methyl]piperidine-1-carbonyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 119183261 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 5-[3-[(butanoylamino)methyl]piperidine-1-carbonyl]thiophene-2-carboxylic acid |
| SMILES | CCCC(=O)NCC1CCCN(C(=O)c2ccc(C(=O)O)s2)C1 |
| InChI | InChI=1S/C16H22N2O4S/c1-2-4-14(19)17-9-11-5-3-8-18(10-11)15(20)12-6-7-13(23-12)16(21)22/h6-7,11H,2-5,8-10H2,1H3,(H,17,19)(H,21,22) |
| InChIKey | ZOXUFCAIEFEYBL-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |