C20H30N2O2 — CID 95158748
N-[[(3R)-1-[(2R)-2-phenylbutanoyl]piperidin-3-yl]methyl]butanamide (PubChem CID 95158748) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is N-[[(3R)-1-[(2R)-2-phenylbutanoyl]piperidin-3-yl]methyl]butanamide.
| Compound Name | N-[[(3R)-1-[(2R)-2-phenylbutanoyl]piperidin-3-yl]methyl]butanamide |
|---|---|
| PubChem CID | 95158748 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | N-[[(3R)-1-[(2R)-2-phenylbutanoyl]piperidin-3-yl]methyl]butanamide |
| SMILES | CCCC(=O)NC[C@H]1CCCN(C(=O)[C@H](CC)c2ccccc2)C1 |
| InChI | InChI=1S/C20H30N2O2/c1-3-9-19(23)21-14-16-10-8-13-22(15-16)20(24)18(4-2)17-11-6-5-7-12-17/h5-7,11-12,16,18H,3-4,8-10,13-15H2,1-2H3,(H,21,23)/t16-,18-/m1/s1 |
| InChIKey | WBNHEZMFSCMBJS-SJLPKXTDSA-N |
| XLogP | 3.34 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |