C19H28N4O2 — CID 95292303
N-[[(3S)-1-[6-(cyclopropylamino)pyridine-3-carbonyl]piperidin-3-yl]methyl]butanamide (PubChem CID 95292303) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is N-[[(3S)-1-[6-(cyclopropylamino)pyridine-3-carbonyl]piperidin-3-yl]methyl]butanamide.
| Compound Name | N-[[(3S)-1-[6-(cyclopropylamino)pyridine-3-carbonyl]piperidin-3-yl]methyl]butanamide |
|---|---|
| PubChem CID | 95292303 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | N-[[(3S)-1-[6-(cyclopropylamino)pyridine-3-carbonyl]piperidin-3-yl]methyl]butanamide |
| SMILES | CCCC(=O)NC[C@@H]1CCCN(C(=O)c2ccc(NC3CC3)nc2)C1 |
| InChI | InChI=1S/C19H28N4O2/c1-2-4-18(24)21-11-14-5-3-10-23(13-14)19(25)15-6-9-17(20-12-15)22-16-7-8-16/h6,9,12,14,16H,2-5,7-8,10-11,13H2,1H3,(H,20,22)(H,21,24)/t14-/m0/s1 |
| InChIKey | ICLIXEUEWLYVDS-AWEZNQCLSA-N |
| XLogP | 2.42 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |