C14H20Cl2N2O — CID 119821044
(4-amino-2-chlorophenyl)-(3-propan-2-ylpyrrolidin-1-yl)methanone;hydrochloride (PubChem CID 119821044) has the molecular formula C14H20Cl2N2O and a molecular weight of 303.23 g/mol. Its IUPAC name is (4-amino-2-chlorophenyl)-(3-propan-2-ylpyrrolidin-1-yl)methanone;hydrochloride.
| Compound Name | (4-amino-2-chlorophenyl)-(3-propan-2-ylpyrrolidin-1-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119821044 |
| Molecular Formula | C14H20Cl2N2O |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.10 |
| IUPAC Name | (4-amino-2-chlorophenyl)-(3-propan-2-ylpyrrolidin-1-yl)methanone;hydrochloride |
| SMILES | CC(C)C1CCN(C(=O)c2ccc(N)cc2Cl)C1.Cl |
| InChI | InChI=1S/C14H19ClN2O.ClH/c1-9(2)10-5-6-17(8-10)14(18)12-4-3-11(16)7-13(12)15;/h3-4,7,9-10H,5-6,8,16H2,1-2H3;1H |
| InChIKey | WPKFZPKTZBRZQJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|