C20H33N3O — CID 91683039
[5-amino-2-[di(propan-2-yl)amino]phenyl]-(3,5-dimethylpiperidin-1-yl)methanone (PubChem CID 91683039) has the molecular formula C20H33N3O and a molecular weight of 331.50 g/mol. Its IUPAC name is [5-amino-2-[di(propan-2-yl)amino]phenyl]-(3,5-dimethylpiperidin-1-yl)methanone.
| Compound Name | [5-amino-2-[di(propan-2-yl)amino]phenyl]-(3,5-dimethylpiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 91683039 |
| Molecular Formula | C20H33N3O |
| Molecular Weight | 331.50 g/mol |
| Exact Mass | 331.26 |
| IUPAC Name | [5-amino-2-[di(propan-2-yl)amino]phenyl]-(3,5-dimethylpiperidin-1-yl)methanone |
| SMILES | CC1CC(C)CN(C(=O)c2cc(N)ccc2N(C(C)C)C(C)C)C1 |
| InChI | InChI=1S/C20H33N3O/c1-13(2)23(14(3)4)19-8-7-17(21)10-18(19)20(24)22-11-15(5)9-16(6)12-22/h7-8,10,13-16H,9,11-12,21H2,1-6H3 |
| InChIKey | CNRIYIYOCYWCKV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.50 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|