C10H10Cl2O2 — CID 171007863
1-(2,4-dichloro-5-ethoxyphenyl)ethanone (PubChem CID 171007863) has the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. Its IUPAC name is 1-(2,4-dichloro-5-ethoxyphenyl)ethanone.
| Compound Name | 1-(2,4-dichloro-5-ethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 171007863 |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | 1-(2,4-dichloro-5-ethoxyphenyl)ethanone |
| SMILES | CCOc1cc(C(C)=O)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl2O2/c1-3-14-10-4-7(6(2)13)8(11)5-9(10)12/h4-5H,3H2,1-2H3 |
| InChIKey | LWRXOAFFDTYDAR-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.09 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |