C11H14ClNO3 — CID 82268164
2-chloro-4,5-diethoxybenzamide (PubChem CID 82268164) has the molecular formula C11H14ClNO3 and a molecular weight of 243.69 g/mol. Its IUPAC name is 2-chloro-4,5-diethoxybenzamide.
| Compound Name | 2-chloro-4,5-diethoxybenzamide |
|---|---|
| PubChem CID | 82268164 |
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.69 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 2-chloro-4,5-diethoxybenzamide |
| SMILES | CCOc1cc(Cl)c(C(N)=O)cc1OCC |
| InChI | InChI=1S/C11H14ClNO3/c1-3-15-9-5-7(11(13)14)8(12)6-10(9)16-4-2/h5-6H,3-4H2,1-2H3,(H2,13,14) |
| InChIKey | UUZDHQDEACHTIV-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.69 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |