C14H17ClO5 — CID 82551579
ethyl 2-(4-chloro-2,5-diethoxyphenyl)-2-oxoacetate (PubChem CID 82551579) has the molecular formula C14H17ClO5 and a molecular weight of 300.74 g/mol. Its IUPAC name is ethyl 2-(4-chloro-2,5-diethoxyphenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(4-chloro-2,5-diethoxyphenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 82551579 |
| Molecular Formula | C14H17ClO5 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | ethyl 2-(4-chloro-2,5-diethoxyphenyl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(OCC)c(Cl)cc1OCC |
| InChI | InChI=1S/C14H17ClO5/c1-4-18-11-8-10(15)12(19-5-2)7-9(11)13(16)14(17)20-6-3/h7-8H,4-6H2,1-3H3 |
| InChIKey | ALEQTCNWPWERJA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|