C10H7Cl3O3 — CID 82550947
ethyl 2-oxo-2-(2,3,4-trichlorophenyl)acetate (PubChem CID 82550947) has the molecular formula C10H7Cl3O3 and a molecular weight of 281.52 g/mol. Its IUPAC name is ethyl 2-oxo-2-(2,3,4-trichlorophenyl)acetate.
| Compound Name | ethyl 2-oxo-2-(2,3,4-trichlorophenyl)acetate |
|---|---|
| PubChem CID | 82550947 |
| Molecular Formula | C10H7Cl3O3 |
| Molecular Weight | 281.52 g/mol |
| Exact Mass | 279.95 |
| IUPAC Name | ethyl 2-oxo-2-(2,3,4-trichlorophenyl)acetate |
| SMILES | CCOC(=O)C(=O)c1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C10H7Cl3O3/c1-2-16-10(15)9(14)5-3-4-6(11)8(13)7(5)12/h3-4H,2H2,1H3 |
| InChIKey | DCOHNTGUGSTQQL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.52 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|