C11H10Cl2O4 — CID 117443637
ethyl 2-(2,5-dichloro-3-methoxyphenyl)-2-oxoacetate (PubChem CID 117443637) has the molecular formula C11H10Cl2O4 and a molecular weight of 277.10 g/mol. Its IUPAC name is ethyl 2-(2,5-dichloro-3-methoxyphenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(2,5-dichloro-3-methoxyphenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 117443637 |
| Molecular Formula | C11H10Cl2O4 |
| Molecular Weight | 277.10 g/mol |
| Exact Mass | 276.00 |
| IUPAC Name | ethyl 2-(2,5-dichloro-3-methoxyphenyl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(Cl)cc(OC)c1Cl |
| InChI | InChI=1S/C11H10Cl2O4/c1-3-17-11(15)10(14)7-4-6(12)5-8(16-2)9(7)13/h4-5H,3H2,1-2H3 |
| InChIKey | WSNZVYUEQSVAMP-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.10 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|