C12H13ClO6 — CID 117466332
ethyl 2-(3-chloro-2-hydroxy-4,5-dimethoxyphenyl)-2-oxoacetate (PubChem CID 117466332) has the molecular formula C12H13ClO6 and a molecular weight of 288.68 g/mol. Its IUPAC name is ethyl 2-(3-chloro-2-hydroxy-4,5-dimethoxyphenyl)-2-oxoacetate.
| Compound Name | ethyl 2-(3-chloro-2-hydroxy-4,5-dimethoxyphenyl)-2-oxoacetate |
|---|---|
| PubChem CID | 117466332 |
| Molecular Formula | C12H13ClO6 |
| Molecular Weight | 288.68 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | ethyl 2-(3-chloro-2-hydroxy-4,5-dimethoxyphenyl)-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)c1cc(OC)c(OC)c(Cl)c1O |
| InChI | InChI=1S/C12H13ClO6/c1-4-19-12(16)10(15)6-5-7(17-2)11(18-3)8(13)9(6)14/h5,14H,4H2,1-3H3 |
| InChIKey | AJQTUCJXGXPSFL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.68 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|