C12H12O7 — CID 117423954
5-(2-ethoxy-2-oxoacetyl)-2-hydroxy-4-methoxybenzoic acid (PubChem CID 117423954) has the molecular formula C12H12O7 and a molecular weight of 268.22 g/mol. Its IUPAC name is 5-(2-ethoxy-2-oxoacetyl)-2-hydroxy-4-methoxybenzoic acid.
| Compound Name | 5-(2-ethoxy-2-oxoacetyl)-2-hydroxy-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 117423954 |
| Molecular Formula | C12H12O7 |
| Molecular Weight | 268.22 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 5-(2-ethoxy-2-oxoacetyl)-2-hydroxy-4-methoxybenzoic acid |
| SMILES | CCOC(=O)C(=O)c1cc(C(=O)O)c(O)cc1OC |
| InChI | InChI=1S/C12H12O7/c1-3-19-12(17)10(14)7-4-6(11(15)16)8(13)5-9(7)18-2/h4-5,13H,3H2,1-2H3,(H,15,16) |
| InChIKey | JYCKELZCNJXVKY-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.22 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|