C11H10O7 — CID 117388254
5-(2-ethoxy-2-oxoacetyl)-2,4-dihydroxybenzoic acid (PubChem CID 117388254) has the molecular formula C11H10O7 and a molecular weight of 254.19 g/mol. Its IUPAC name is 5-(2-ethoxy-2-oxoacetyl)-2,4-dihydroxybenzoic acid.
| Compound Name | 5-(2-ethoxy-2-oxoacetyl)-2,4-dihydroxybenzoic acid |
|---|---|
| PubChem CID | 117388254 |
| Molecular Formula | C11H10O7 |
| Molecular Weight | 254.19 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-(2-ethoxy-2-oxoacetyl)-2,4-dihydroxybenzoic acid |
| SMILES | CCOC(=O)C(=O)c1cc(C(=O)O)c(O)cc1O |
| InChI | InChI=1S/C11H10O7/c1-2-18-11(17)9(14)5-3-6(10(15)16)8(13)4-7(5)12/h3-4,12-13H,2H2,1H3,(H,15,16) |
| InChIKey | VCKHFTVMNNIIEZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.19 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|