C10H13NO5 — CID 117326312
5-(1-amino-2-hydroxyethyl)-2-hydroxy-4-methoxybenzoic acid (PubChem CID 117326312) has the molecular formula C10H13NO5 and a molecular weight of 227.22 g/mol. Its IUPAC name is 5-(1-amino-2-hydroxyethyl)-2-hydroxy-4-methoxybenzoic acid.
| Compound Name | 5-(1-amino-2-hydroxyethyl)-2-hydroxy-4-methoxybenzoic acid |
|---|---|
| PubChem CID | 117326312 |
| Molecular Formula | C10H13NO5 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 5-(1-amino-2-hydroxyethyl)-2-hydroxy-4-methoxybenzoic acid |
| SMILES | COc1cc(O)c(C(=O)O)cc1C(N)CO |
| InChI | InChI=1S/C10H13NO5/c1-16-9-3-8(13)6(10(14)15)2-5(9)7(11)4-12/h2-3,7,12-13H,4,11H2,1H3,(H,14,15) |
| InChIKey | JPPOANZCBQNKTP-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |