C11H15F2NO3 — CID 117369704
2-amino-2-[5-(difluoromethyl)-2,4-dimethoxyphenyl]ethanol (PubChem CID 117369704) has the molecular formula C11H15F2NO3 and a molecular weight of 247.24 g/mol. Its IUPAC name is 2-amino-2-[5-(difluoromethyl)-2,4-dimethoxyphenyl]ethanol.
| Compound Name | 2-amino-2-[5-(difluoromethyl)-2,4-dimethoxyphenyl]ethanol |
|---|---|
| PubChem CID | 117369704 |
| Molecular Formula | C11H15F2NO3 |
| Molecular Weight | 247.24 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 2-amino-2-[5-(difluoromethyl)-2,4-dimethoxyphenyl]ethanol |
| SMILES | COc1cc(OC)c(C(N)CO)cc1C(F)F |
| InChI | InChI=1S/C11H15F2NO3/c1-16-9-4-10(17-2)7(11(12)13)3-6(9)8(14)5-15/h3-4,8,11,15H,5,14H2,1-2H3 |
| InChIKey | SFBJFBFOKTUAEG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.24 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |