C11H17NO2 — CID 77129776
2-amino-2-(2-methoxy-4,5-dimethylphenyl)ethanol (PubChem CID 77129776) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 2-amino-2-(2-methoxy-4,5-dimethylphenyl)ethanol.
| Compound Name | 2-amino-2-(2-methoxy-4,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 77129776 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 2-amino-2-(2-methoxy-4,5-dimethylphenyl)ethanol |
| SMILES | COc1cc(C)c(C)cc1C(N)CO |
| InChI | InChI=1S/C11H17NO2/c1-7-4-9(10(12)6-13)11(14-3)5-8(7)2/h4-5,10,13H,6,12H2,1-3H3 |
| InChIKey | KDFMZSGPXPNLST-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |