C11H17NO — CID 17389879
2-amino-2-(2,4,5-trimethylphenyl)ethanol (PubChem CID 17389879) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 2-amino-2-(2,4,5-trimethylphenyl)ethanol.
| Compound Name | 2-amino-2-(2,4,5-trimethylphenyl)ethanol |
|---|---|
| PubChem CID | 17389879 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 2-amino-2-(2,4,5-trimethylphenyl)ethanol |
| SMILES | Cc1cc(C)c(C(N)CO)cc1C |
| InChI | InChI=1S/C11H17NO/c1-7-4-9(3)10(5-8(7)2)11(12)6-13/h4-5,11,13H,6,12H2,1-3H3 |
| InChIKey | GKSHQZSSTGBJAT-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |