C10H14FNO — CID 84769051
2-amino-2-(2-fluoro-4,5-dimethylphenyl)ethanol (PubChem CID 84769051) has the molecular formula C10H14FNO and a molecular weight of 183.23 g/mol. Its IUPAC name is 2-amino-2-(2-fluoro-4,5-dimethylphenyl)ethanol.
| Compound Name | 2-amino-2-(2-fluoro-4,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 84769051 |
| Molecular Formula | C10H14FNO |
| Molecular Weight | 183.23 g/mol |
| Exact Mass | 183.11 |
| IUPAC Name | 2-amino-2-(2-fluoro-4,5-dimethylphenyl)ethanol |
| SMILES | Cc1cc(F)c(C(N)CO)cc1C |
| InChI | InChI=1S/C10H14FNO/c1-6-3-8(10(12)5-13)9(11)4-7(6)2/h3-4,10,13H,5,12H2,1-2H3 |
| InChIKey | JETOSWQTECDCCP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.23 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |