C11H17NOS — CID 117302199
2-amino-2-(4,5-dimethyl-2-methylsulfanylphenyl)ethanol (PubChem CID 117302199) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is 2-amino-2-(4,5-dimethyl-2-methylsulfanylphenyl)ethanol.
| Compound Name | 2-amino-2-(4,5-dimethyl-2-methylsulfanylphenyl)ethanol |
|---|---|
| PubChem CID | 117302199 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | 2-amino-2-(4,5-dimethyl-2-methylsulfanylphenyl)ethanol |
| SMILES | CSc1cc(C)c(C)cc1C(N)CO |
| InChI | InChI=1S/C11H17NOS/c1-7-4-9(10(12)6-13)11(14-3)5-8(7)2/h4-5,10,13H,6,12H2,1-3H3 |
| InChIKey | ZCPCGZCPAUCRTF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |