C11H17NS — CID 117285815
1-(4,5-dimethyl-2-methylsulfanylphenyl)ethanamine (PubChem CID 117285815) has the molecular formula C11H17NS and a molecular weight of 195.33 g/mol. Its IUPAC name is 1-(4,5-dimethyl-2-methylsulfanylphenyl)ethanamine.
| Compound Name | 1-(4,5-dimethyl-2-methylsulfanylphenyl)ethanamine |
|---|---|
| PubChem CID | 117285815 |
| Molecular Formula | C11H17NS |
| Molecular Weight | 195.33 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 1-(4,5-dimethyl-2-methylsulfanylphenyl)ethanamine |
| SMILES | CSc1cc(C)c(C)cc1C(C)N |
| InChI | InChI=1S/C11H17NS/c1-7-5-10(9(3)12)11(13-4)6-8(7)2/h5-6,9H,12H2,1-4H3 |
| InChIKey | UWQXFTFFHIAREX-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.33 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |