methyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate

C12H16O3S — CID 117353748

IUPACmethyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate
SMILESCOC(=O)C(O)c1cc(C)c(C)cc1SC
InChIInChI=1S/C12H16O3S/c1-7-5-9(11(13)12(14)15-3)10(16-4)6-8(7)2/h5-6,11,13H,1-4H3
InChIKeyTVZWTDQGDDWAIT-UHFFFAOYSA-N
MW240.32 g/mol
LogP2.23
Rot. Bonds3

About methyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate

methyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate (PubChem CID 117353748) has the molecular formula C12H16O3S and a molecular weight of 240.32 g/mol. Its IUPAC name is methyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate.

Molecular Properties

Compound Namemethyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate
PubChem CID117353748
Molecular FormulaC12H16O3S
Molecular Weight240.32 g/mol
Exact Mass240.08
IUPAC Namemethyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate
SMILESCOC(=O)C(O)c1cc(C)c(C)cc1SC
InChIInChI=1S/C12H16O3S/c1-7-5-9(11(13)12(14)15-3)10(16-4)6-8(7)2/h5-6,11,13H,1-4H3
InChIKeyTVZWTDQGDDWAIT-UHFFFAOYSA-N
XLogP2.23
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.32
LogP ≤ 52.23
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze methyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate?
The IUPAC name of methyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate (CID 117353748) is methyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate.
What is the SMILES notation for methyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate?
The canonical SMILES for methyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate is COC(=O)C(O)c1cc(C)c(C)cc1SC.
What is the InChIKey of methyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate?
The InChIKey is TVZWTDQGDDWAIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3S/c1-7-5-9(11(13)12(14)15-3)10(16-4)6-8(7)2/h5-6,11,13H,1-4H3.
What are the key properties of methyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate?
methyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate has a molecular weight of 240.32 g/mol, XLogP of 2.23, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(4,5-dimethyl-2-methylsulfanylphenyl)-2-hydroxyacetate is sourced from PubChem (CID 117353748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).