methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate

C11H14O3S2 — CID 117399691

IUPACmethyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate
SMILESCOC(=O)C(O)c1ccc(SC)c(SC)c1
InChIInChI=1S/C11H14O3S2/c1-14-11(13)10(12)7-4-5-8(15-2)9(6-7)16-3/h4-6,10,12H,1-3H3
InChIKeyMKPUYTHEHRFERX-UHFFFAOYSA-N
MW258.36 g/mol
LogP2.34
Rot. Bonds4

About methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate

methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate (PubChem CID 117399691) has the molecular formula C11H14O3S2 and a molecular weight of 258.36 g/mol. Its IUPAC name is methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate.

Molecular Properties

Compound Namemethyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate
PubChem CID117399691
Molecular FormulaC11H14O3S2
Molecular Weight258.36 g/mol
Exact Mass258.04
IUPAC Namemethyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate
SMILESCOC(=O)C(O)c1ccc(SC)c(SC)c1
InChIInChI=1S/C11H14O3S2/c1-14-11(13)10(12)7-4-5-8(15-2)9(6-7)16-3/h4-6,10,12H,1-3H3
InChIKeyMKPUYTHEHRFERX-UHFFFAOYSA-N
XLogP2.34
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.36
LogP ≤ 52.34
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate?
The IUPAC name of methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate (CID 117399691) is methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate.
What is the SMILES notation for methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate?
The canonical SMILES for methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate is COC(=O)C(O)c1ccc(SC)c(SC)c1.
What is the InChIKey of methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate?
The InChIKey is MKPUYTHEHRFERX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14O3S2/c1-14-11(13)10(12)7-4-5-8(15-2)9(6-7)16-3/h4-6,10,12H,1-3H3.
What are the key properties of methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate?
methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate has a molecular weight of 258.36 g/mol, XLogP of 2.34, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate is sourced from PubChem (CID 117399691), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).