C11H14O3S2 — CID 117399691
methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate (PubChem CID 117399691) has the molecular formula C11H14O3S2 and a molecular weight of 258.36 g/mol. Its IUPAC name is methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate.
| Compound Name | methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate |
|---|---|
| PubChem CID | 117399691 |
| Molecular Formula | C11H14O3S2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | methyl 2-[3,4-bis(methylsulfanyl)phenyl]-2-hydroxyacetate |
| SMILES | COC(=O)C(O)c1ccc(SC)c(SC)c1 |
| InChI | InChI=1S/C11H14O3S2/c1-14-11(13)10(12)7-4-5-8(15-2)9(6-7)16-3/h4-6,10,12H,1-3H3 |
| InChIKey | MKPUYTHEHRFERX-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |