C17H16F2O6 — CID 161223884
(2R)-2-(4-fluorophenyl)-2-hydroxyacetic acid;methyl 2-(4-fluorophenyl)-2-hydroxyacetate (PubChem CID 161223884) has the molecular formula C17H16F2O6 and a molecular weight of 354.31 g/mol. Its IUPAC name is (2R)-2-(4-fluorophenyl)-2-hydroxyacetic acid;methyl 2-(4-fluorophenyl)-2-hydroxyacetate.
| Compound Name | (2R)-2-(4-fluorophenyl)-2-hydroxyacetic acid;methyl 2-(4-fluorophenyl)-2-hydroxyacetate |
|---|---|
| PubChem CID | 161223884 |
| Molecular Formula | C17H16F2O6 |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | (2R)-2-(4-fluorophenyl)-2-hydroxyacetic acid;methyl 2-(4-fluorophenyl)-2-hydroxyacetate |
| SMILES | COC(=O)C(O)c1ccc(F)cc1.O=C(O)[C@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H9FO3.C8H7FO3/c1-13-9(12)8(11)6-2-4-7(10)5-3-6;9-6-3-1-5(2-4-6)7(10)8(11)12/h2-5,8,11H,1H3;1-4,7,10H,(H,11,12)/t;7-/m.1/s1 |
| InChIKey | UXWICPUSFIBSBM-HMZWWLAASA-N |
| XLogP | 1.98 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |