C10H11FO4 — CID 15056442
methyl 3-(4-fluorophenyl)-2,3-dihydroxypropanoate (PubChem CID 15056442) has the molecular formula C10H11FO4 and a molecular weight of 214.19 g/mol. Its IUPAC name is methyl 3-(4-fluorophenyl)-2,3-dihydroxypropanoate.
| Compound Name | methyl 3-(4-fluorophenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 15056442 |
| Molecular Formula | C10H11FO4 |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | methyl 3-(4-fluorophenyl)-2,3-dihydroxypropanoate |
| SMILES | COC(=O)C(O)C(O)c1ccc(F)cc1 |
| InChI | InChI=1S/C10H11FO4/c1-15-10(14)9(13)8(12)6-2-4-7(11)5-3-6/h2-5,8-9,12-13H,1H3 |
| InChIKey | CBMHFYZDPQFNNM-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |