C9H8FO4- — CID 44629566
(2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoate (PubChem CID 44629566) has the molecular formula C9H8FO4- and a molecular weight of 199.16 g/mol. Its IUPAC name is (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoate.
| Compound Name | (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoate |
|---|---|
| PubChem CID | 44629566 |
| Molecular Formula | C9H8FO4- |
| Molecular Weight | 199.16 g/mol |
| Exact Mass | 199.04 |
| IUPAC Name | (2S,3S)-3-(4-fluorophenyl)-2,3-dihydroxypropanoate |
| SMILES | O=C([O-])[C@@H](O)[C@@H](O)c1ccc(F)cc1 |
| InChI | InChI=1S/C9H9FO4/c10-6-3-1-5(2-4-6)7(11)8(12)9(13)14/h1-4,7-8,11-12H,(H,13,14)/p-1/t7-,8-/m0/s1 |
| InChIKey | DWYLYIVEFVSGCP-YUMQZZPRSA-M |
| XLogP | -1.03 |
| TPSA | 80.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.16 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |