5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid

C10H9FO6 — CID 170824217

IUPAC5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid
SMILESO=C(O)c1cc(C(O)C(O)C(=O)O)ccc1F
InChIInChI=1S/C10H9FO6/c11-6-2-1-4(3-5(6)9(14)15)7(12)8(13)10(16)17/h1-3,7-8,12-13H,(H,14,15)(H,16,17)
InChIKeyGHUQEARHZSZUTD-UHFFFAOYSA-N
MW244.17 g/mol
LogP0.00
Rot. Bonds4

About 5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid

5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid (PubChem CID 170824217) has the molecular formula C10H9FO6 and a molecular weight of 244.17 g/mol. Its IUPAC name is 5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid.

Molecular Properties

Compound Name5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid
PubChem CID170824217
Molecular FormulaC10H9FO6
Molecular Weight244.17 g/mol
Exact Mass244.04
IUPAC Name5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid
SMILESO=C(O)c1cc(C(O)C(O)C(=O)O)ccc1F
InChIInChI=1S/C10H9FO6/c11-6-2-1-4(3-5(6)9(14)15)7(12)8(13)10(16)17/h1-3,7-8,12-13H,(H,14,15)(H,16,17)
InChIKeyGHUQEARHZSZUTD-UHFFFAOYSA-N
XLogP0.00
TPSA115.06 Ų
H-Bond Donors4
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500244.17
LogP ≤ 50.00
H-Bond Donors ≤ 54
H-Bond Acceptors ≤ 104

Analyze 5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid?
The IUPAC name of 5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid (CID 170824217) is 5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid.
What is the SMILES notation for 5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid?
The canonical SMILES for 5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid is O=C(O)c1cc(C(O)C(O)C(=O)O)ccc1F.
What is the InChIKey of 5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid?
The InChIKey is GHUQEARHZSZUTD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FO6/c11-6-2-1-4(3-5(6)9(14)15)7(12)8(13)10(16)17/h1-3,7-8,12-13H,(H,14,15)(H,16,17).
What are the key properties of 5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid?
5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid has a molecular weight of 244.17 g/mol, XLogP of 0.00, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-carboxy-1,2-dihydroxyethyl)-2-fluorobenzoic acid is sourced from PubChem (CID 170824217), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).