2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid

C9H7F3O4 — CID 170823796

IUPAC2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid
SMILESO=C(O)C(O)C(O)c1cc(F)c(F)c(F)c1
InChIInChI=1S/C9H7F3O4/c10-4-1-3(2-5(11)6(4)12)7(13)8(14)9(15)16/h1-2,7-8,13-14H,(H,15,16)
InChIKeyNJOBUWYORJFVRH-UHFFFAOYSA-N
MW236.14 g/mol
LogP0.58
Rot. Bonds3

About 2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid

2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid (PubChem CID 170823796) has the molecular formula C9H7F3O4 and a molecular weight of 236.14 g/mol. Its IUPAC name is 2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid.

Molecular Properties

Compound Name2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid
PubChem CID170823796
Molecular FormulaC9H7F3O4
Molecular Weight236.14 g/mol
Exact Mass236.03
IUPAC Name2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid
SMILESO=C(O)C(O)C(O)c1cc(F)c(F)c(F)c1
InChIInChI=1S/C9H7F3O4/c10-4-1-3(2-5(11)6(4)12)7(13)8(14)9(15)16/h1-2,7-8,13-14H,(H,15,16)
InChIKeyNJOBUWYORJFVRH-UHFFFAOYSA-N
XLogP0.58
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500236.14
LogP ≤ 50.58
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}

Analyze 2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid?
The IUPAC name of 2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid (CID 170823796) is 2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid.
What is the SMILES notation for 2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid?
The canonical SMILES for 2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid is O=C(O)C(O)C(O)c1cc(F)c(F)c(F)c1.
What is the InChIKey of 2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid?
The InChIKey is NJOBUWYORJFVRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3O4/c10-4-1-3(2-5(11)6(4)12)7(13)8(14)9(15)16/h1-2,7-8,13-14H,(H,15,16).
What are the key properties of 2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid?
2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid has a molecular weight of 236.14 g/mol, XLogP of 0.58, 3 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydroxy-3-(3,4,5-trifluorophenyl)propanoic acid is sourced from PubChem (CID 170823796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).