C9H5F5O3 — CID 63075977
2,2-difluoro-3-hydroxy-3-(3,4,5-trifluorophenyl)propanoic acid (PubChem CID 63075977) has the molecular formula C9H5F5O3 and a molecular weight of 256.13 g/mol. Its IUPAC name is 2,2-difluoro-3-hydroxy-3-(3,4,5-trifluorophenyl)propanoic acid.
| Compound Name | 2,2-difluoro-3-hydroxy-3-(3,4,5-trifluorophenyl)propanoic acid |
|---|---|
| PubChem CID | 63075977 |
| Molecular Formula | C9H5F5O3 |
| Molecular Weight | 256.13 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 2,2-difluoro-3-hydroxy-3-(3,4,5-trifluorophenyl)propanoic acid |
| SMILES | O=C(O)C(F)(F)C(O)c1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C9H5F5O3/c10-4-1-3(2-5(11)6(4)12)7(15)9(13,14)8(16)17/h1-2,7,15H,(H,16,17) |
| InChIKey | HVSDGNJCTVPAJB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.13 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|