C8H5F6N — CID 56971920
(1R)-2,2,2-trifluoro-1-(3,4,5-trifluorophenyl)ethanamine (PubChem CID 56971920) has the molecular formula C8H5F6N and a molecular weight of 229.12 g/mol. Its IUPAC name is (1R)-2,2,2-trifluoro-1-(3,4,5-trifluorophenyl)ethanamine.
| Compound Name | (1R)-2,2,2-trifluoro-1-(3,4,5-trifluorophenyl)ethanamine |
|---|---|
| PubChem CID | 56971920 |
| Molecular Formula | C8H5F6N |
| Molecular Weight | 229.12 g/mol |
| Exact Mass | 229.03 |
| IUPAC Name | (1R)-2,2,2-trifluoro-1-(3,4,5-trifluorophenyl)ethanamine |
| SMILES | N[C@H](c1cc(F)c(F)c(F)c1)C(F)(F)F |
| InChI | InChI=1S/C8H5F6N/c9-4-1-3(2-5(10)6(4)11)7(15)8(12,13)14/h1-2,7H,15H2/t7-/m1/s1 |
| InChIKey | KRFBRUSCINUESW-SSDOTTSWSA-N |
| XLogP | 2.67 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.12 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|