C8H6F6N2 — CID 66511828
2-[(1S)-1-amino-2,2,2-trifluoroethyl]-3,4,6-trifluoroaniline (PubChem CID 66511828) has the molecular formula C8H6F6N2 and a molecular weight of 244.14 g/mol. Its IUPAC name is 2-[(1S)-1-amino-2,2,2-trifluoroethyl]-3,4,6-trifluoroaniline.
| Compound Name | 2-[(1S)-1-amino-2,2,2-trifluoroethyl]-3,4,6-trifluoroaniline |
|---|---|
| PubChem CID | 66511828 |
| Molecular Formula | C8H6F6N2 |
| Molecular Weight | 244.14 g/mol |
| Exact Mass | 244.04 |
| IUPAC Name | 2-[(1S)-1-amino-2,2,2-trifluoroethyl]-3,4,6-trifluoroaniline |
| SMILES | Nc1c(F)cc(F)c(F)c1[C@H](N)C(F)(F)F |
| InChI | InChI=1S/C8H6F6N2/c9-2-1-3(10)6(15)4(5(2)11)7(16)8(12,13)14/h1,7H,15-16H2/t7-/m0/s1 |
| InChIKey | MKMDSITXYBPXFM-ZETCQYMHSA-N |
| XLogP | 2.25 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.14 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|