C8H7F5N2 — CID 66511440
2-[(1R)-1-amino-2,2,2-trifluoroethyl]-4,6-difluoroaniline (PubChem CID 66511440) has the molecular formula C8H7F5N2 and a molecular weight of 226.15 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2,2-trifluoroethyl]-4,6-difluoroaniline.
| Compound Name | 2-[(1R)-1-amino-2,2,2-trifluoroethyl]-4,6-difluoroaniline |
|---|---|
| PubChem CID | 66511440 |
| Molecular Formula | C8H7F5N2 |
| Molecular Weight | 226.15 g/mol |
| Exact Mass | 226.05 |
| IUPAC Name | 2-[(1R)-1-amino-2,2,2-trifluoroethyl]-4,6-difluoroaniline |
| SMILES | Nc1c(F)cc(F)cc1[C@@H](N)C(F)(F)F |
| InChI | InChI=1S/C8H7F5N2/c9-3-1-4(6(14)5(10)2-3)7(15)8(11,12)13/h1-2,7H,14-15H2/t7-/m1/s1 |
| InChIKey | ZECKQTADSFLONN-SSDOTTSWSA-N |
| XLogP | 2.11 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.15 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|