C8H8F4N2O — CID 66511506
2-amino-6-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-fluorophenol (PubChem CID 66511506) has the molecular formula C8H8F4N2O and a molecular weight of 224.16 g/mol. Its IUPAC name is 2-amino-6-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-fluorophenol.
| Compound Name | 2-amino-6-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-fluorophenol |
|---|---|
| PubChem CID | 66511506 |
| Molecular Formula | C8H8F4N2O |
| Molecular Weight | 224.16 g/mol |
| Exact Mass | 224.06 |
| IUPAC Name | 2-amino-6-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-fluorophenol |
| SMILES | Nc1cc(F)cc([C@@H](N)C(F)(F)F)c1O |
| InChI | InChI=1S/C8H8F4N2O/c9-3-1-4(6(15)5(13)2-3)7(14)8(10,11)12/h1-2,7,15H,13-14H2/t7-/m1/s1 |
| InChIKey | QAPNONSMWANFEN-SSDOTTSWSA-N |
| XLogP | 1.68 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.16 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|