C8H6F4N2O3 — CID 66511647
2-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-fluoro-6-nitrophenol (PubChem CID 66511647) has the molecular formula C8H6F4N2O3 and a molecular weight of 254.14 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-fluoro-6-nitrophenol.
| Compound Name | 2-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-fluoro-6-nitrophenol |
|---|---|
| PubChem CID | 66511647 |
| Molecular Formula | C8H6F4N2O3 |
| Molecular Weight | 254.14 g/mol |
| Exact Mass | 254.03 |
| IUPAC Name | 2-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-fluoro-6-nitrophenol |
| SMILES | N[C@H](c1cc(F)cc([N+](=O)[O-])c1O)C(F)(F)F |
| InChI | InChI=1S/C8H6F4N2O3/c9-3-1-4(7(13)8(10,11)12)6(15)5(2-3)14(16)17/h1-2,7,15H,13H2/t7-/m1/s1 |
| InChIKey | KHRDOBBDTYDQRC-SSDOTTSWSA-N |
| XLogP | 2.00 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.14 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|