C10H9F3N2O5 — CID 66512196
2-[3-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-hydroxy-5-nitrophenyl]acetic acid (PubChem CID 66512196) has the molecular formula C10H9F3N2O5 and a molecular weight of 294.19 g/mol. Its IUPAC name is 2-[3-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-hydroxy-5-nitrophenyl]acetic acid.
| Compound Name | 2-[3-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-hydroxy-5-nitrophenyl]acetic acid |
|---|---|
| PubChem CID | 66512196 |
| Molecular Formula | C10H9F3N2O5 |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 294.05 |
| IUPAC Name | 2-[3-[(1R)-1-amino-2,2,2-trifluoroethyl]-4-hydroxy-5-nitrophenyl]acetic acid |
| SMILES | N[C@H](c1cc(CC(=O)O)cc([N+](=O)[O-])c1O)C(F)(F)F |
| InChI | InChI=1S/C10H9F3N2O5/c11-10(12,13)9(14)5-1-4(3-7(16)17)2-6(8(5)18)15(19)20/h1-2,9,18H,3,14H2,(H,16,17)/t9-/m1/s1 |
| InChIKey | RRQICTVMIPHWQA-SECBINFHSA-N |
| XLogP | 1.49 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|