C9H7F3N2O5 — CID 66511932
3-[(1S)-1-amino-2,2,2-trifluoroethyl]-2-hydroxy-4-nitrobenzoic acid (PubChem CID 66511932) has the molecular formula C9H7F3N2O5 and a molecular weight of 280.16 g/mol. Its IUPAC name is 3-[(1S)-1-amino-2,2,2-trifluoroethyl]-2-hydroxy-4-nitrobenzoic acid.
| Compound Name | 3-[(1S)-1-amino-2,2,2-trifluoroethyl]-2-hydroxy-4-nitrobenzoic acid |
|---|---|
| PubChem CID | 66511932 |
| Molecular Formula | C9H7F3N2O5 |
| Molecular Weight | 280.16 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 3-[(1S)-1-amino-2,2,2-trifluoroethyl]-2-hydroxy-4-nitrobenzoic acid |
| SMILES | N[C@@H](c1c([N+](=O)[O-])ccc(C(=O)O)c1O)C(F)(F)F |
| InChI | InChI=1S/C9H7F3N2O5/c10-9(11,12)7(13)5-4(14(18)19)2-1-3(6(5)15)8(16)17/h1-2,7,15H,13H2,(H,16,17)/t7-/m0/s1 |
| InChIKey | FGKNAJFWYYRWFX-ZETCQYMHSA-N |
| XLogP | 1.56 |
| TPSA | 126.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.16 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|