C10H13ClF2N2O4 — CID 171255326
2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-6-methyl-3-nitrophenol;hydrochloride (PubChem CID 171255326) has the molecular formula C10H13ClF2N2O4 and a molecular weight of 298.67 g/mol. Its IUPAC name is 2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-6-methyl-3-nitrophenol;hydrochloride.
| Compound Name | 2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-6-methyl-3-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171255326 |
| Molecular Formula | C10H13ClF2N2O4 |
| Molecular Weight | 298.67 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | 2-[(1R)-1-amino-2,2-difluoro-3-hydroxypropyl]-6-methyl-3-nitrophenol;hydrochloride |
| SMILES | Cc1ccc([N+](=O)[O-])c([C@@H](N)C(F)(F)CO)c1O.Cl |
| InChI | InChI=1S/C10H12F2N2O4.ClH/c1-5-2-3-6(14(17)18)7(8(5)16)9(13)10(11,12)4-15;/h2-3,9,15-16H,4,13H2,1H3;1H/t9-;/m1./s1 |
| InChIKey | UFLVXOBZOKRXDE-SBSPUUFOSA-N |
| XLogP | 1.66 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.67 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|