C9H11ClF2N2O4 — CID 171248510
3-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]-4-nitrophenol;hydrochloride (PubChem CID 171248510) has the molecular formula C9H11ClF2N2O4 and a molecular weight of 284.65 g/mol. Its IUPAC name is 3-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]-4-nitrophenol;hydrochloride.
| Compound Name | 3-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]-4-nitrophenol;hydrochloride |
|---|---|
| PubChem CID | 171248510 |
| Molecular Formula | C9H11ClF2N2O4 |
| Molecular Weight | 284.65 g/mol |
| Exact Mass | 284.04 |
| IUPAC Name | 3-[(1S)-1-amino-2,2-difluoro-3-hydroxypropyl]-4-nitrophenol;hydrochloride |
| SMILES | Cl.N[C@@H](c1cc(O)ccc1[N+](=O)[O-])C(F)(F)CO |
| InChI | InChI=1S/C9H10F2N2O4.ClH/c10-9(11,4-14)8(12)6-3-5(15)1-2-7(6)13(16)17;/h1-3,8,14-15H,4,12H2;1H/t8-;/m0./s1 |
| InChIKey | OVOVBVYEYLLHKD-QRPNPIFTSA-N |
| XLogP | 1.35 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.65 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|